Difference between revisions of "SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=...")
(Created page with "Category:metabolite == Metabolite CPD-8624 == * common-name: ** a [protein]-l-proline (ω = 180) == Reaction(s) known to consume the compound == * PEPTIDYLPROLYL-IS...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17383 ==
+
== Metabolite CPD-8624 ==
 
* common-name:
 
* common-name:
** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a [protein]-l-proline (ω = 180)
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** mmzjvinjfsrjok-cynjbpnesa-j
 
* molecular-weight:
 
** 1102.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16130]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a [protein]-l-proline (ω = 180)}}
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
 
{{#set: molecular-weight=1102.034}}
 

Revision as of 14:53, 5 January 2021

Metabolite CPD-8624

  • common-name:
    • a [protein]-l-proline (ω = 180)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-proline (ω = 180)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.