Difference between revisions of "SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20508 == * transcription-direction: ** positive * right-end-position: ** 20857 * left-end-position: ** 3390 * centisome-position: ** 1.6363451...")
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20508 ==
+
== Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 20857
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
−
* left-end-position:
+
* inchi-key:
−
** 3390
+
** bjlpwucpfajinb-uaqstnrtsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 1.6363451   
+
** 442.531
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.5.1.42-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.223-RXN]]
+
* [[2.5.1.41-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
−
* [[2.4.1.229-RXN]]
+
{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=442.531}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6558]]
 
−
** '''7''' reactions found over '''13''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=20857}}
 
−
{{#set: left-end-position=3390}}
 
−
{{#set: centisome-position=1.6363451    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE

  • common-name:
    • 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
  • inchi-key:
    • bjlpwucpfajinb-uaqstnrtsa-l
  • molecular-weight:
    • 442.531

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE&oldid=136726"