Difference between revisions of "SN-GLYCEROL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-313 == * common-name: ** propane-1,3-diamine * smiles: ** c(cc[n+])[n+] * inchi-key: ** xfnjvjplkcpibv-uhfffaoysa-p * molecular-weigh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-313 == |
* common-name: | * common-name: | ||
| − | ** | + | ** propane-1,3-diamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc[n+])[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xfnjvjplkcpibv-uhfffaoysa-p |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 76.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.5.1.46-RXN]] |
| − | * [[ | + | * [[RXN-13415]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=propane-1,3-diamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xfnjvjplkcpibv-uhfffaoysa-p}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=76.141}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite CPD-313
- common-name:
- propane-1,3-diamine
- smiles:
- c(cc[n+])[n+]
- inchi-key:
- xfnjvjplkcpibv-uhfffaoysa-p
- molecular-weight:
- 76.141
