Difference between revisions of "SN-GLYCEROL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-313 == * common-name: ** propane-1,3-diamine * smiles: ** c(cc[n+])[n+] * inchi-key: ** xfnjvjplkcpibv-uhfffaoysa-p * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SN-GLYCEROL-1-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sn-glycerol 1-phosphate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(op([o-])(=o)[o-])c(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** awucvroldviajx-vkhmyheasa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 170.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.5.1.41-RXN]] | ||
| + | * [[RXN-14964]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sn-glycerol 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.058}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite SN-GLYCEROL-1-PHOSPHATE
- common-name:
- sn-glycerol 1-phosphate
- smiles:
- c(op([o-])(=o)[o-])c(o)co
- inchi-key:
- awucvroldviajx-vkhmyheasa-l
- molecular-weight:
- 170.058
