Difference between revisions of "SN-GLYCEROL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00999 == * transcription-direction: ** negative * right-end-position: ** 142390 * left-end-position: ** 131873 * centisome-position: ** 83.04345...") |
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SN-GLYCEROL-1-PHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** sn-glycerol 1-phosphate |
− | + | * smiles: | |
− | * | + | ** c(op([o-])(=o)[o-])c(o)co |
− | + | * inchi-key: | |
− | ** | + | ** awucvroldviajx-vkhmyheasa-l |
− | + | * molecular-weight: | |
− | + | ** 170.058 | |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[2.5.1.41-RXN]] | |
− | + | * [[RXN-14964]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=sn-glycerol 1-phosphate}} |
− | + | {{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}} | |
− | + | {{#set: molecular-weight=170.058}} | |
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite SN-GLYCEROL-1-PHOSPHATE
- common-name:
- sn-glycerol 1-phosphate
- smiles:
- c(op([o-])(=o)[o-])c(o)co
- inchi-key:
- awucvroldviajx-vkhmyheasa-l
- molecular-weight:
- 170.058