Difference between revisions of "SN-GLYCEROL-1-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00999 == * transcription-direction: ** negative * right-end-position: ** 142390 * left-end-position: ** 131873 * centisome-position: ** 83.04345...")
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00999 ==
+
== Metabolite SN-GLYCEROL-1-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** sn-glycerol 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 142390
+
** c(op([o-])(=o)[o-])c(o)co
−
* left-end-position:
+
* inchi-key:
−
** 131873
+
** awucvroldviajx-vkhmyheasa-l
−
* centisome-position:
+
* molecular-weight:
−
** 83.04345   
+
** 170.058
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.5.1.41-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-14964]]
−
* [[GLYCPDIESTER-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=sn-glycerol 1-phosphate}}
−
* [[RXN-14073]]
+
{{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=170.058}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14136]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14160]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6952]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7409]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=142390}}
 
−
{{#set: left-end-position=131873}}
 
−
{{#set: centisome-position=83.04345    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite SN-GLYCEROL-1-PHOSPHATE

  • common-name:
    • sn-glycerol 1-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c(o)co
  • inchi-key:
    • awucvroldviajx-vkhmyheasa-l
  • molecular-weight:
    • 170.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SN-GLYCEROL-1-PHOSPHATE&oldid=138143"