Difference between revisions of "SN-GLYCEROL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03551 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-8443 ** Category:...") |
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite SN-GLYCEROL-1-PHOSPHATE == |
| − | = | + | * common-name: |
| − | * | + | ** sn-glycerol 1-phosphate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[RXN | + | ** c(op([o-])(=o)[o-])c(o)co |
| − | * | + | * inchi-key: |
| − | + | ** awucvroldviajx-vkhmyheasa-l | |
| − | == | + | * molecular-weight: |
| − | + | ** 170.058 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | * [[2.5.1.41-RXN]] |
| − | {{#set: | + | * [[RXN-14964]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=sn-glycerol 1-phosphate}} | ||
| + | {{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}} | ||
| + | {{#set: molecular-weight=170.058}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite SN-GLYCEROL-1-PHOSPHATE
- common-name:
- sn-glycerol 1-phosphate
- smiles:
- c(op([o-])(=o)[o-])c(o)co
- inchi-key:
- awucvroldviajx-vkhmyheasa-l
- molecular-weight:
- 170.058
