Difference between revisions of "SN-GLYCEROL-1-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SN-GLYCEROL-1-PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** sn-glycerol 1-phosphate |
* smiles: | * smiles: | ||
− | ** c | + | ** c(op([o-])(=o)[o-])c(o)co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** awucvroldviajx-vkhmyheasa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 170.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.5.1.41-RXN]] |
− | + | * [[RXN-14964]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=sn-glycerol 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.058}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite SN-GLYCEROL-1-PHOSPHATE
- common-name:
- sn-glycerol 1-phosphate
- smiles:
- c(op([o-])(=o)[o-])c(o)co
- inchi-key:
- awucvroldviajx-vkhmyheasa-l
- molecular-weight:
- 170.058