Difference between revisions of "SOLANESYL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02225 == * transcription-direction: ** negative * right-end-position: ** 114947 * left-end-position: ** 113601 * centisome-position: ** 81.201...")
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02225 ==
+
== Metabolite SOLANESYL-PYROPHOSPHATE ==
* transcription-direction:
+
* common-name:
** negative
+
** all-trans-nonaprenyl diphosphate
* right-end-position:
+
* smiles:
** 114947
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
* left-end-position:
+
* inchi-key:
** 113601
+
** ivlbhbftrnviap-meggaxogsa-k
* centisome-position:
+
* molecular-weight:
** 81.201   
+
** 788.015
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-2761]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
+
* [[RXN-11486]]
** Category: [[annotation]]
+
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
{{#set: transcription-direction=negative}}
+
{{#set: common-name=all-trans-nonaprenyl diphosphate}}
{{#set: right-end-position=114947}}
+
{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
{{#set: left-end-position=113601}}
+
{{#set: molecular-weight=788.015}}
{{#set: centisome-position=81.201    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite SOLANESYL-PYROPHOSPHATE

  • common-name:
    • all-trans-nonaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ivlbhbftrnviap-meggaxogsa-k
  • molecular-weight:
    • 788.015

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality