Difference between revisions of "SOLANESYL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glucopyranose == * common-name: ** d-glucopyranose == Reaction(s) known to consume the compound == * GLUCISOM-RXN * GLUCOKIN-RXN...")
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glucopyranose ==
+
== Metabolite SOLANESYL-PYROPHOSPHATE ==
 
* common-name:
 
* common-name:
** d-glucopyranose
+
** all-trans-nonaprenyl diphosphate
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 +
* inchi-key:
 +
** ivlbhbftrnviap-meggaxogsa-k
 +
* molecular-weight:
 +
** 788.015
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCISOM-RXN]]
+
* [[RXN-2761]]
* [[GLUCOKIN-RXN]]
 
* [[LACTOSE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-11486]]
* [[2.3.1.91-RXN]]
+
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
* [[3.2.1.21-RXN]]
 
* [[3.2.1.39-RXN]]
 
* [[3.2.1.84-RXN]]
 
* [[ALPHAGALACTOSID-RXN]]
 
* [[BETAGALACTOSID-RXN]]
 
* [[GLUCISOM-RXN]]
 
* [[GLUCOSYLCERAMIDASE-RXN]]
 
* [[KETOLACTOSE-RXN]]
 
* [[MALTODEXGLUCOSID-RXN]]
 
* [[RXN-10769]]
 
* [[RXN-10773]]
 
* [[RXN-13600]]
 
* [[RXN-13602]]
 
* [[RXN-13603]]
 
* [[RXN-14179]]
 
* [[RXN-14281]]
 
* [[RXN-14282]]
 
* [[RXN-14283]]
 
* [[RXN-15910]]
 
* [[RXN-5341]]
 
* [[RXN-8036]]
 
* [[RXN-9674]]
 
* [[RXN0-5183]]
 
* [[RXN0-5395]]
 
* [[RXN66-526]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucopyranose}}
+
{{#set: common-name=all-trans-nonaprenyl diphosphate}}
 +
{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
 +
{{#set: molecular-weight=788.015}}

Latest revision as of 11:11, 18 March 2021

Metabolite SOLANESYL-PYROPHOSPHATE

  • common-name:
    • all-trans-nonaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ivlbhbftrnviap-meggaxogsa-k
  • molecular-weight:
    • 788.015

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality