Difference between revisions of "SOLANESYL-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21863 == * transcription-direction: ** positive * right-end-position: ** 102674 * left-end-position: ** 97880 * centisome-position: ** 52.936436...") |
(Created page with "Category:metabolite == Metabolite CANAVANINE == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=[n+])n * inchi-key: ** fsbigdsbmbyopn-vkhmyheasa-o * m...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CANAVANINE == |
− | * | + | * common-name: |
− | ** | + | ** l-canavanine |
− | * | + | * smiles: |
− | ** | + | ** c(cc([n+])c(=o)[o-])onc(=[n+])n |
− | * | + | * inchi-key: |
− | ** | + | ** fsbigdsbmbyopn-vkhmyheasa-o |
− | * | + | * molecular-weight: |
− | ** | + | ** 177.183 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-34]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-22]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-canavanine}} | |
− | + | {{#set: inchi-key=inchikey=fsbigdsbmbyopn-vkhmyheasa-o}} | |
− | + | {{#set: molecular-weight=177.183}} | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CANAVANINE
- common-name:
- l-canavanine
- smiles:
- c(cc([n+])c(=o)[o-])onc(=[n+])n
- inchi-key:
- fsbigdsbmbyopn-vkhmyheasa-o
- molecular-weight:
- 177.183