Difference between revisions of "SOLANESYL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21863 == * transcription-direction: ** positive * right-end-position: ** 102674 * left-end-position: ** 97880 * centisome-position: ** 52.936436...")
(Created page with "Category:metabolite == Metabolite CANAVANINE == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=[n+])n * inchi-key: ** fsbigdsbmbyopn-vkhmyheasa-o * m...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21863 ==
+
== Metabolite CANAVANINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-canavanine
−
* right-end-position:
+
* smiles:
−
** 102674
+
** c(cc([n+])c(=o)[o-])onc(=[n+])n
−
* left-end-position:
+
* inchi-key:
−
** 97880
+
** fsbigdsbmbyopn-vkhmyheasa-o
−
* centisome-position:
+
* molecular-weight:
−
** 52.936436   
+
** 177.183
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-34]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+
* [[RXN-22]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=l-canavanine}}
−
* [[RXN-1321]]
+
{{#set: inchi-key=inchikey=fsbigdsbmbyopn-vkhmyheasa-o}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=177.183}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-8497]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5410]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-735]]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-6917]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5406]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5407]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5408]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=102674}}
 
−
{{#set: left-end-position=97880}}
 
−
{{#set: centisome-position=52.936436    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:30, 18 December 2020

Metabolite CANAVANINE

  • common-name:
    • l-canavanine
  • smiles:
    • c(cc([n+])c(=o)[o-])onc(=[n+])n
  • inchi-key:
    • fsbigdsbmbyopn-vkhmyheasa-o
  • molecular-weight:
    • 177.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SOLANESYL-PYROPHOSPHATE&oldid=45739"