Difference between revisions of "SORBITOL"

Revision as of 14:58, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12120 ==
+== Metabolite ASCORBATE ==
 * common-name:
-** demethylmenaquinol-11
+** l-ascorbate
 * smiles:
-** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
+** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1)
 * inchi-key:
-** wvrzwraihitkpi-sokmhqjssa-n
+** ciwbshskhkdkbq-jlaznsocsa-m
 * molecular-weight:
-** 909.472
+** 175.118
 == Reaction(s) known to consume the compound ==
-* [[RXN-9362]]
+* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+* [[ETHYL-RXN]]
+* [[RXN-12440]]
+* [[RXN-13185]]
+* [[RXN-15598]]
+* [[RXN-19200]]
+* [[RXN-3521]]
+* [[RXN-7984]]
+* [[RXN-7985]]
 == Reaction(s) known to produce the compound ==
+* [[1.3.3.12-RXN]]
+* [[1.6.5.4-RXN]]
+* [[1.8.5.1-RXN]]
+* [[RXN-11153]]
+* [[RXN-12440]]
+* [[RXN-13185]]
+* [[RXN-13689]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=demethylmenaquinol-11}}
+{{#set: common-name=l-ascorbate}}
-{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
+{{#set: inchi-key=inchikey=ciwbshskhkdkbq-jlaznsocsa-m}}
-{{#set: molecular-weight=909.472}}
+{{#set: molecular-weight=175.118}}