Difference between revisions of "SORBITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASCORBATE == * common-name: ** l-ascorbate * smiles: ** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1) * inchi-key: ** ciwbshskhkdkbq-jlaznsocsa-m *...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ASCORBATE ==
+
== Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE ==
 
* common-name:
 
* common-name:
** l-ascorbate
+
** 3,4-dihydroxyphenylglycolaldehyde
 
* smiles:
 
* smiles:
** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1)
+
** c(=o)c(o)c1(c=cc(o)=c(o)c=1)
 
* inchi-key:
 
* inchi-key:
** ciwbshskhkdkbq-jlaznsocsa-m
+
** yugmcljiwgekck-qmmmgpobsa-n
 
* molecular-weight:
 
* molecular-weight:
** 175.118
+
** 168.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[RXN-10911]]
* [[ETHYL-RXN]]
+
* [[RXN-10912]]
* [[RXN-12440]]
 
* [[RXN-13185]]
 
* [[RXN-15598]]
 
* [[RXN-19200]]
 
* [[RXN-3521]]
 
* [[RXN-7984]]
 
* [[RXN-7985]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.3.12-RXN]]
+
* [[RXN-10907]]
* [[1.6.5.4-RXN]]
+
* [[RXN-10908]]
* [[1.8.5.1-RXN]]
 
* [[RXN-11153]]
 
* [[RXN-12440]]
 
* [[RXN-13185]]
 
* [[RXN-13689]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-ascorbate}}
+
{{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}}
{{#set: inchi-key=inchikey=ciwbshskhkdkbq-jlaznsocsa-m}}
+
{{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}}
{{#set: molecular-weight=175.118}}
+
{{#set: molecular-weight=168.149}}

Revision as of 15:29, 5 January 2021

Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylglycolaldehyde
  • smiles:
    • c(=o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • yugmcljiwgekck-qmmmgpobsa-n
  • molecular-weight:
    • 168.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality