Difference between revisions of "SPERMIDINE"

Latest revision as of 11:14, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-7063 ==
+== Metabolite SPERMIDINE ==
 * common-name:
-** red chlorophyll catabolite
+** spermidine
 * smiles:
-** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
+** c([n+])cc[n+]cccc[n+]
 * inchi-key:
-** gvtpycxgtfqzdt-yssugppcsa-m
+** athghqpfgpmsjy-uhfffaoysa-q
 * molecular-weight:
-** 624.692
+** 148.271
 == Reaction(s) known to consume the compound ==
-* [[RXN-7741]]
+* [[2.5.1.46-RXN]]
+* [[ABC-24-RXN]]
+* [[RXN-11190]]
+* [[RXN-13414]]
+* [[SPERMIDINESYN-RXN]]
+* [[SPERMINE-SYNTHASE-RXN]]
+* [[SPMDtmi]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-7740]]
+* [[ABC-24-RXN]]
+* [[APAPT]]
+* [[RXN-11190]]
+* [[SPERMIDINESYN-RXN]]
+* [[SPMDtmi]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=red chlorophyll catabolite}}
+{{#set: common-name=spermidine}}
-{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
+{{#set: inchi-key=inchikey=athghqpfgpmsjy-uhfffaoysa-q}}
-{{#set: molecular-weight=624.692}}
+{{#set: molecular-weight=148.271}}