Difference between revisions of "SPERMIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-...")
(Created page with "Category:metabolite == Metabolite SPERMIDINE == * common-name: ** spermidine * smiles: ** c([n+])cc[n+]cccc[n+] * inchi-key: ** athghqpfgpmsjy-uhfffaoysa-q * molecular-wei...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19726 ==
+
== Metabolite SPERMIDINE ==
 
* common-name:
 
* common-name:
** (4s)-2,3-dehydro-leucocyanidin
+
** spermidine
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
+
** c([n+])cc[n+]cccc[n+]
 
* inchi-key:
 
* inchi-key:
** yaagnrwejszflv-zdusscgksa-n
+
** athghqpfgpmsjy-uhfffaoysa-q
 
* molecular-weight:
 
* molecular-weight:
** 304.256
+
** 148.271
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.5.1.46-RXN]]
 +
* [[ABC-24-RXN]]
 +
* [[RXN-11190]]
 +
* [[RXN-13414]]
 +
* [[SPERMIDINESYN-RXN]]
 +
* [[SPERMINE-SYNTHASE-RXN]]
 +
* [[SPMDtmi]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-602]]
+
* [[ABC-24-RXN]]
 +
* [[APAPT]]
 +
* [[RXN-11190]]
 +
* [[SPERMIDINESYN-RXN]]
 +
* [[SPMDtmi]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}}
+
{{#set: common-name=spermidine}}
{{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}}
+
{{#set: inchi-key=inchikey=athghqpfgpmsjy-uhfffaoysa-q}}
{{#set: molecular-weight=304.256}}
+
{{#set: molecular-weight=148.271}}

Latest revision as of 11:14, 18 March 2021

Metabolite SPERMIDINE

  • common-name:
    • spermidine
  • smiles:
    • c([n+])cc[n+]cccc[n+]
  • inchi-key:
    • athghqpfgpmsjy-uhfffaoysa-q
  • molecular-weight:
    • 148.271

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality