Difference between revisions of "SPERMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-157 RXN1G-157] == * direction: ** left-to-right * common-name: ** 3-oxo-behenoyl-[acyl-carrie...")
(Created page with "Category:metabolite == Metabolite SPERMINE == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * inchi-key: ** pfnffqxmrsdohw-uhfffaoysa-r * molecular-...")
 
(8 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-157 RXN1G-157] ==
+
== Metabolite SPERMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxo-behenoyl-[acyl-carrier protein] reductase
+
** spermine
−
** 3-oxoacyl-[acyl-carrier-protein] reductase
+
* smiles:
−
** 3-oxoacyl-[acyl-carrier-protein] reductase (nadph)
+
** c(ccc[n+]ccc[n+])[n+]ccc[n+]
−
* ec-number:
+
* inchi-key:
−
** [http://enzyme.expasy.org/EC/1.1.1.100 ec-1.1.1.100]
+
** pfnffqxmrsdohw-uhfffaoysa-r
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[3-oxo-behenoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[R-3-hydroxybehenoyl-ACPs]][c]
+
** 206.374
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ17743]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[SPERMINE-SYNTHASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ04229]]
+
{{#set: common-name=spermine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=pfnffqxmrsdohw-uhfffaoysa-r}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=206.374}}
−
* Gene: [[SJ13014]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-oxo-behenoyl-[acyl-carrier protein] reductase|3-oxoacyl-[acyl-carrier-protein] reductase|3-oxoacyl-[acyl-carrier-protein] reductase (nadph)}}
 
−
{{#set: ec-number=ec-1.1.1.100}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SPERMINE

  • common-name:
    • spermine
  • smiles:
    • c(ccc[n+]ccc[n+])[n+]ccc[n+]
  • inchi-key:
    • pfnffqxmrsdohw-uhfffaoysa-r
  • molecular-weight:
    • 206.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SPERMINE&oldid=138557"