Difference between revisions of "SPHINGOLIPID-SYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c...")
 
(Created page with "Category:pathway == Pathway SPHINGOLIPID-SYN-PWY == * taxonomic-range: ** tax-4751 * common-name: ** sphingolipid biosynthesis (yeast) == Reaction(s) found == * 3-DEHYDR...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] ==
+
== Pathway SPHINGOLIPID-SYN-PWY ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** reduced β-nicotinamide d-ribonucleotide
+
** sphingolipid biosynthesis (yeast)
* smiles:
+
== Reaction(s) found ==
** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
+
* [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]]
* inchi-key:
+
* [[RXN3O-328]]
** xqhmusrslnrvga-turqnecasa-l
+
* [[RXN3O-581]]
* molecular-weight:
+
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
** 334.222
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-20394 RXN-20394]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-20397 RXN-20397]
* [[RXN0-4401]]
+
* [NoneRXN3O-680 RXN3O-680]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN3O-1380 RXN3O-1380]
{{#set: common-name=reduced β-nicotinamide d-ribonucleotide}}
+
* [NoneRXN-20396 RXN-20396]
{{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}}
+
* [NoneRXN3O-663 RXN3O-663]
{{#set: molecular-weight=334.222}}
+
* [NoneRXN-12642 RXN-12642]
 +
{{#set: taxonomic-range=tax-4751}}
 +
{{#set: common-name=sphingolipid biosynthesis (yeast)}}
 +
{{#set: nb reaction found=4}}
 +
{{#set: completion rate=0.36}}
 +
{{#set: nb total reaction=11}}

Latest revision as of 10:58, 18 March 2021

Pathway SPHINGOLIPID-SYN-PWY

  • taxonomic-range:
    • tax-4751
  • common-name:
    • sphingolipid biosynthesis (yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-20394 RXN-20394]
  • [NoneRXN-20397 RXN-20397]
  • [NoneRXN3O-680 RXN3O-680]
  • [NoneRXN3O-1380 RXN3O-1380]
  • [NoneRXN-20396 RXN-20396]
  • [NoneRXN3O-663 RXN3O-663]
  • [NoneRXN-12642 RXN-12642]