Difference between revisions of "SPHINGOLIPID-SYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * common-name: ** ent-kaurenol * smiles: ** c=c1(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-915-DIOXOPROSTA-13-ENOATE HYDROXY-915-DIOXOPROSTA-13-ENOATE] == * common-name: ** 15-de...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-915-DIOXOPROSTA-13-ENOATE HYDROXY-915-DIOXOPROSTA-13-ENOATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 15-dehydro-prostaglandin e2 |
* smiles: | * smiles: | ||
− | ** c= | + | ** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yrtjdwrobkpznv-kmxmbppjsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 349.446 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[1.1.1.141-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[1. | + | * [[1.1.1.141-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=15-dehydro-prostaglandin e2}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=349.446}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE
- common-name:
- 15-dehydro-prostaglandin e2
- smiles:
- cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
- inchi-key:
- yrtjdwrobkpznv-kmxmbppjsa-m
- molecular-weight:
- 349.446