Difference between revisions of "SPHINGOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * smiles: ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite SPHINGOSINE == * common-name: ** sphingosine * smiles: ** cccccccccccccc=cc(o)c([n+])co * inchi-key: ** wwuziqqurgpmpg-krwokugfsa-o * mol...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SPHINGOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sphingosine |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccc=cc(o)c([n+])co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wwuziqqurgpmpg-krwokugfsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 300.504 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN3DJ-11417]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN3DJ-25]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sphingosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wwuziqqurgpmpg-krwokugfsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=300.504}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SPHINGOSINE
- common-name:
- sphingosine
- smiles:
- cccccccccccccc=cc(o)c([n+])co
- inchi-key:
- wwuziqqurgpmpg-krwokugfsa-o
- molecular-weight:
- 300.504
