|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FGAMSYN-RXN FGAMSYN-RXN] == | + | == Metabolite SQUALENE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** phosphoribosylformylglycinamide synthetase | + | ** squalene |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.3.5.3 ec-6.3.5.3] | + | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
| + | ** yygntywphwgjrm-aajylucbsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ09235]] | + | ** 410.725 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[SMO]] |
| − | ** Category: [[orthology]] | + | * [[SQUALENE-MONOOXYGENASE-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-13162]] |
| − | * Gene: [[SJ09236]]
| + | * [[RXN-13724]] |
| − | ** Category: [[annotation]]
| + | * [[RXN66-281]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[SMO]] |
| − | == Pathway(s) == | + | == Reaction(s) of unknown directionality == |
| − | * [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277] | + | {{#set: common-name=squalene}} |
| − | ** '''6''' reactions found over '''5''' reactions in the full pathway
| + | {{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}} |
| − | * [[PWY-6121]], 5-aminoimidazole ribonucleotide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6121 PWY-6121] | + | {{#set: molecular-weight=410.725}} |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links ==
| |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17129 17129]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04463 R04463]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/O67691 O67691]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9UXW5 Q9UXW5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PNY0 Q9PNY0]
| |
| − | ** [http://www.uniprot.org/uniprot/O28339 O28339]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PHZ7 Q9PHZ7]
| |
| − | ** [http://www.uniprot.org/uniprot/O26270 O26270]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59042 Q59042]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58660 Q58660]
| |
| − | ** [http://www.uniprot.org/uniprot/O27427 O27427]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JWC5 Q9JWC5]
| |
| − | ** [http://www.uniprot.org/uniprot/P35852 P35852]
| |
| − | ** [http://www.uniprot.org/uniprot/P38972 P38972]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55843 Q55843]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55037 Q55037]
| |
| − | ** [http://www.uniprot.org/uniprot/P12041 P12041]
| |
| − | ** [http://www.uniprot.org/uniprot/P12042 P12042]
| |
| − | ** [http://www.uniprot.org/uniprot/P15254 P15254]
| |
| − | ** [http://www.uniprot.org/uniprot/O14228 O14228]
| |
| − | ** [http://www.uniprot.org/uniprot/P35421 P35421]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZB07 Q9ZB07]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZB06 Q9ZB06]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=phosphoribosylformylglycinamide synthetase}} | |
| − | {{#set: ec-number=ec-6.3.5.3}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
| |
