Difference between revisions of "SQUALENE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FGAMSYN-RXN FGAMSYN-RXN] == * direction: ** left-to-right * common-name: ** phosphoribosylformylgly...") |
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SQUALENE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** squalene |
− | * | + | * smiles: |
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c |
− | == | + | * inchi-key: |
− | + | ** yygntywphwgjrm-aajylucbsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 410.725 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | * [[SMO]] | |
− | * | + | * [[SQUALENE-MONOOXYGENASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13162]] | |
− | + | * [[RXN-13724]] | |
− | + | * [[RXN66-281]] | |
− | ** | + | * [[SMO]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | {{#set: common-name=squalene}} |
− | + | {{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}} | |
− | * [[ | + | {{#set: molecular-weight=410.725}} |
− | |||
− | |||
− | |||
− | == | ||
− | * | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SQUALENE
- common-name:
- squalene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
- inchi-key:
- yygntywphwgjrm-aajylucbsa-n
- molecular-weight:
- 410.725