Difference between revisions of "SQUALENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.38-RXN 3.2.1.38-RXN] == * direction: ** left-to-right * common-name: ** beta-d-fucosidase * e...")
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.38-RXN 3.2.1.38-RXN] ==
+
== Metabolite SQUALENE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** beta-d-fucosidase
+
** squalene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.2.1.38 ec-3.2.1.38]
+
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Beta-D-fucosides]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-13293]][c] '''+''' 1 [[Non-Fucosylated-Fucose-Acceptors]][c]
+
** yygntywphwgjrm-aajylucbsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04558]]
+
** 410.725
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[SMO]]
−
== Pathway(s) ==
+
* [[SQUALENE-MONOOXYGENASE-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13162]]
−
== External links  ==
+
* [[RXN-13724]]
−
* UNIPROT:
+
* [[RXN66-281]]
−
** [http://www.uniprot.org/uniprot/P94248 P94248]
+
* [[SMO]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=beta-d-fucosidase}}
+
{{#set: common-name=squalene}}
−
{{#set: ec-number=ec-3.2.1.38}}
+
{{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=410.725}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SQUALENE

  • common-name:
    • squalene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • yygntywphwgjrm-aajylucbsa-n
  • molecular-weight:
    • 410.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SQUALENE&oldid=138736"