Difference between revisions of "SQUALENE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Pyrimidine-Bases == * common-name: ** a pyrimidine base == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...") |
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SQUALENE == |
* common-name: | * common-name: | ||
− | ** | + | ** squalene |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c | ||
+ | * inchi-key: | ||
+ | ** yygntywphwgjrm-aajylucbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 410.725 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[SMO]] | ||
+ | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13162]] |
+ | * [[RXN-13724]] | ||
+ | * [[RXN66-281]] | ||
+ | * [[SMO]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=squalene}} |
+ | {{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}} | ||
+ | {{#set: molecular-weight=410.725}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SQUALENE
- common-name:
- squalene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
- inchi-key:
- yygntywphwgjrm-aajylucbsa-n
- molecular-weight:
- 410.725