Difference between revisions of "SQUALENE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2744 == * common-name: ** nicotine-glucuronide * smiles: ** c1(cc[ch]([n+](c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3)) * in...") |
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SQUALENE == |
* common-name: | * common-name: | ||
| − | ** | + | ** squalene |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yygntywphwgjrm-aajylucbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 410.725 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SMO]] | ||
| + | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN66- | + | * [[RXN-13162]] |
| + | * [[RXN-13724]] | ||
| + | * [[RXN66-281]] | ||
| + | * [[SMO]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=squalene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=410.725}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SQUALENE
- common-name:
- squalene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
- inchi-key:
- yygntywphwgjrm-aajylucbsa-n
- molecular-weight:
- 410.725
