Difference between revisions of "SQUALENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERDEAM-RXN HOMOSERDEAM-RXN] == * direction: ** left-to-right * common-name: ** cystathionine g...")
 
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERDEAM-RXN HOMOSERDEAM-RXN] ==
+
== Metabolite SQUALENE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** cystathionine gamma-lyase
+
** squalene
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.4.1.1 ec-4.4.1.1]
+
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[HOMO-SER]][c] '''=>''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[AMMONIUM]][c]
+
** yygntywphwgjrm-aajylucbsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ05357]]
+
** 410.725
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[SMO]]
* Gene: [[SJ05358]]
+
* [[SQUALENE-MONOOXYGENASE-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-13162]]
* Gene: [[SJ20026]]
+
* [[RXN-13724]]
** Category: [[annotation]]
+
* [[RXN66-281]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[SMO]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=squalene}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}}
== Reconstruction information  ==
+
{{#set: molecular-weight=410.725}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24924 24924]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=cystathionine gamma-lyase}}
 
{{#set: ec-number=ec-4.4.1.1}}
 
{{#set: nb gene associated=3}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SQUALENE

  • common-name:
    • squalene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • yygntywphwgjrm-aajylucbsa-n
  • molecular-weight:
    • 410.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality