Difference between revisions of "SS-Oligoribonucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
(Created page with "Category:metabolite == Metabolite SS-Oligoribonucleotides == * common-name: ** a single-stranded oligoribonucleotide == Reaction(s) known to consume the compound == == Rea...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SS-Oligoribonucleotides == |
* common-name: | * common-name: | ||
− | ** | + | ** a single-stranded oligoribonucleotide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.26.11-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a single-stranded oligoribonucleotide}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite SS-Oligoribonucleotides
- common-name:
- a single-stranded oligoribonucleotide