Difference between revisions of "STEARIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-BETA-D-GLUCOSYLGLUCOSE == * common-name: ** nigerose * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) * inchi-key: ** qig...") |
(Created page with "Category:metabolite == Metabolite STEARIC_ACID == * common-name: ** stearate * smiles: ** cccccccccccccccccc(=o)[o-] * inchi-key: ** qiqxthqidytfrh-uhfffaoysa-m * molecula...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite STEARIC_ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** stearate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qiqxthqidytfrh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 283.473 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.]] |
| + | * [[RXN-16380]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LPLPS1AGPE180h]] | ||
| + | * [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]] | ||
| + | * [[RXN-9548]] | ||
| + | * [[RXN-9624]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=stearate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qiqxthqidytfrh-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=283.473}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite STEARIC_ACID
- common-name:
- stearate
- smiles:
- cccccccccccccccccc(=o)[o-]
- inchi-key:
- qiqxthqidytfrh-uhfffaoysa-m
- molecular-weight:
- 283.473
