Difference between revisions of "STRICTOSIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...")
(Created page with "Category:metabolite == Metabolite STRICTOSIDINE == * common-name: ** 3-α(s)-strictosidine * smiles: ** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRINOGEN ==
+
== Metabolite STRICTOSIDINE ==
 
* common-name:
 
* common-name:
** protoporphyrinogen ix
+
** 3-α(s)-strictosidine
 
* smiles:
 
* smiles:
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
+
** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co))
 
* inchi-key:
 
* inchi-key:
** uhsgpdmiqqynax-uhfffaoysa-l
+
** xbamjztxgwptrm-awtfmmiesa-o
 
* molecular-weight:
 
* molecular-weight:
** 566.699
+
** 531.581
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPPGO]]
 
* [[PROTOPORGENOXI-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEMN-RXN]]
+
* [[STRICTOSIDINE-SYNTHASE-RXN]]
* [[RXN0-1461]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrinogen ix}}
+
{{#set: common-name=3-α(s)-strictosidine}}
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=xbamjztxgwptrm-awtfmmiesa-o}}
{{#set: molecular-weight=566.699}}
+
{{#set: molecular-weight=531.581}}

Latest revision as of 11:13, 18 March 2021

Metabolite STRICTOSIDINE

  • common-name:
    • 3-α(s)-strictosidine
  • smiles:
    • c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co))
  • inchi-key:
    • xbamjztxgwptrm-awtfmmiesa-o
  • molecular-weight:
    • 531.581

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality