Difference between revisions of "STRICTOSIDINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17437 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PROTOPORPHYRINOGEN == |
| − | == | + | * common-name: |
| − | + | ** protoporphyrinogen ix | |
| − | == | + | * smiles: |
| − | + | ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c))) | |
| − | * | + | * inchi-key: |
| − | *** | + | ** uhsgpdmiqqynax-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | + | ** 566.699 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[PPPGO]] |
| − | + | * [[PROTOPORGENOXI-RXN]] | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[HEMN-RXN]] |
| − | + | * [[RXN0-1461]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | {{#set: common-name=protoporphyrinogen ix}} |
| − | + | {{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}} | |
| − | + | {{#set: molecular-weight=566.699}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:33, 18 December 2020
Contents
Metabolite PROTOPORPHYRINOGEN
- common-name:
- protoporphyrinogen ix
- smiles:
- c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
- inchi-key:
- uhsgpdmiqqynax-uhfffaoysa-l
- molecular-weight:
- 566.699
