Difference between revisions of "SUC"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9925 == * common-name: ** 1,4-dihydroxy-2-naphthoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)co...")
(Created page with "Category:metabolite == Metabolite SUC == * common-name: ** succinate * smiles: ** c(c([o-])=o)cc([o-])=o * inchi-key: ** kdyfgrwqoybrfd-uhfffaoysa-l * molecular-weight: **...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9925 ==
+
== Metabolite SUC ==
 
* common-name:
 
* common-name:
** 1,4-dihydroxy-2-naphthoyl-coa
+
** succinate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
+
** c(c([o-])=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** pytinlgpkdjurz-hsjnekgzsa-j
+
** kdyfgrwqoybrfd-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 949.669
+
** 116.073
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FUMARATE-REDUCTASE-NADH-RXN]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-14971]]
 +
* [[RXN-15378]]
 +
* [[RXN-17811]]
 +
* [[RXN-9384]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 +
* [[SUCDHm]]
 +
* [[SUCFUMtmr]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NAPHTHOATE-SYN-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.14.11.1-RXN]]
 +
* [[1.14.11.18-RXN]]
 +
* [[1.14.11.2-RXN]]
 +
* [[FUMARATE-REDUCTASE-NADH-RXN]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
* [[METBALT-RXN]]
 +
* [[MHPCHYDROL-RXN]]
 +
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 +
* [[RXN-113]]
 +
* [[RXN-11320]]
 +
* [[RXN-11321]]
 +
* [[RXN-115]]
 +
* [[RXN-12353]]
 +
* [[RXN-13186]]
 +
* [[RXN-171]]
 +
* [[RXN-17811]]
 +
* [[RXN-527]]
 +
* [[RXN-602]]
 +
* [[RXN-6550]]
 +
* [[RXN-7648]]
 +
* [[RXN-7775]]
 +
* [[RXN-7922]]
 +
* [[RXN-8450]]
 +
* [[RXN-8660]]
 +
* [[RXN-8661]]
 +
* [[RXN-9384]]
 +
* [[RXN-9772]]
 +
* [[RXN0-5293]]
 +
* [[RXN0-7090]]
 +
* [[RXN0-984]]
 +
* [[RXN0-985]]
 +
* [[RXN0-986]]
 +
* [[RXN1F-162]]
 +
* [[RXN1F-163]]
 +
* [[RXN1F-165]]
 +
* [[RXN1F-167]]
 +
* [[RXN1F-168]]
 +
* [[RXN1F-93]]
 +
* [[RXN490-3641]]
 +
* [[RXN66-470]]
 +
* [[SSNOm]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[SUCCSEMIALDDEHYDROG-RXN]]
 +
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 +
* [[SUCFUMtmr]]
 +
* [[SUCHMSSELCYSL]]
 +
* [[SUCHMSSELCYSLh]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,4-dihydroxy-2-naphthoyl-coa}}
+
{{#set: common-name=succinate}}
{{#set: inchi-key=inchikey=pytinlgpkdjurz-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=kdyfgrwqoybrfd-uhfffaoysa-l}}
{{#set: molecular-weight=949.669}}
+
{{#set: molecular-weight=116.073}}

Latest revision as of 11:15, 18 March 2021