Difference between revisions of "SUC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12852 == * common-name: ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]3(ccc4(c)...") |
(Created page with "Category:metabolite == Metabolite CPD-9925 == * common-name: ** 1,4-dihydroxy-2-naphthoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)co...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9925 == |
* common-name: | * common-name: | ||
− | ** 4 | + | ** 1,4-dihydroxy-2-naphthoyl-coa |
* smiles: | * smiles: | ||
− | ** cc(c) | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pytinlgpkdjurz-hsjnekgzsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 949.669 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[NAPHTHOATE-SYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4 | + | {{#set: common-name=1,4-dihydroxy-2-naphthoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pytinlgpkdjurz-hsjnekgzsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=949.669}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-9925
- common-name:
- 1,4-dihydroxy-2-naphthoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
- inchi-key:
- pytinlgpkdjurz-hsjnekgzsa-j
- molecular-weight:
- 949.669