Difference between revisions of "SUC-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...")
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-39 ==
+
== Metabolite SUC-COA ==
 
* common-name:
 
* common-name:
** 3-[(6'-methylthio)hexyl]malate
+
** succinyl-coa
 
* smiles:
 
* smiles:
** csccccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lqqzhlhcfscjcu-uhfffaoysa-l
+
** vnoyujkhfwywir-itiydsspsa-i
 
* molecular-weight:
 
* molecular-weight:
** 262.32
+
** 862.568
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18202]]
+
* [[AKGDHe2r]]
* [[RXNQT-4174]]
+
* [[HOMSUCTRAN-RXN]]
 +
* [[RXN0-1147]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18202]]
+
* [[2OXOGLUTARATEDEH-RXN]]
 +
* [[AKGDHe2r]]
 +
* [[RXN0-1147]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(6'-methylthio)hexyl]malate}}
+
{{#set: common-name=succinyl-coa}}
{{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
{{#set: molecular-weight=262.32}}
+
{{#set: molecular-weight=862.568}}

Latest revision as of 11:15, 18 March 2021

Metabolite SUC-COA

  • common-name:
    • succinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vnoyujkhfwywir-itiydsspsa-i
  • molecular-weight:
    • 862.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality