Difference between revisions of "SUCC-S-ALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9872 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite SUCC-S-ALD == * common-name: ** succinate semialdehyde * smiles: ** c([ch]=o)cc(=o)[o-] * inchi-key: ** uiujiqzeacwqsv-uhfffaoysa-m * mol...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9872 ==
+
== Metabolite SUCC-S-ALD ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
+
** succinate semialdehyde
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
+
** c([ch]=o)cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** glnrsjsltucxtp-iqsnhbbhsa-n
+
** uiujiqzeacwqsv-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 767.229
+
** 101.082
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GABATRANSAM-RXN]]
 +
* [[RXN-14146]]
 +
* [[RXN0-5293]]
 +
* [[SSNOm]]
 +
* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[SUCCSEMIALDDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9242]]
+
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[RXN-14146]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=succinate semialdehyde}}
{{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}}
+
{{#set: inchi-key=inchikey=uiujiqzeacwqsv-uhfffaoysa-m}}
{{#set: molecular-weight=767.229}}
+
{{#set: molecular-weight=101.082}}

Latest revision as of 11:14, 18 March 2021

Metabolite SUCC-S-ALD

  • common-name:
    • succinate semialdehyde
  • smiles:
    • c([ch]=o)cc(=o)[o-]
  • inchi-key:
    • uiujiqzeacwqsv-uhfffaoysa-m
  • molecular-weight:
    • 101.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality