Difference between revisions of "SUCROSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) * inchi-key: ** nzkryjgnypyxjz-u...") |
(Created page with "Category:metabolite == Metabolite SUCROSE == * common-name: ** sucrose * smiles: ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o * inchi-key: ** czmrcdwagmrecn-ugdnzrgbsa...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SUCROSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sucrose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** czmrcdwagmrecn-ugdnzrgbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 342.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.4.1.82-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11502]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sucrose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=czmrcdwagmrecn-ugdnzrgbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.299}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SUCROSE
- common-name:
- sucrose
- smiles:
- c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
- inchi-key:
- czmrcdwagmrecn-ugdnzrgbsa-n
- molecular-weight:
- 342.299
