Difference between revisions of "SUCROSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Dithiols == * common-name: ** a protein dithiol == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS == Re...") |
(Created page with "Category:metabolite == Metabolite SUCROSE == * common-name: ** sucrose * smiles: ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o * inchi-key: ** czmrcdwagmrecn-ugdnzrgbsa...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SUCROSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sucrose |
| + | * smiles: | ||
| + | ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o | ||
| + | * inchi-key: | ||
| + | ** czmrcdwagmrecn-ugdnzrgbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 342.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.82-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11502]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sucrose}} |
| + | {{#set: inchi-key=inchikey=czmrcdwagmrecn-ugdnzrgbsa-n}} | ||
| + | {{#set: molecular-weight=342.299}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SUCROSE
- common-name:
- sucrose
- smiles:
- c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
- inchi-key:
- czmrcdwagmrecn-ugdnzrgbsa-n
- molecular-weight:
- 342.299
