Difference between revisions of "SUCROSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine-adenylate == * common-name: ** a [dna ligase]-n6-(5'-adenylyl)-l-lysine == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-Ligase-L-lysine-adenylate ==
+
== Metabolite DIHYDRONEOPTERIN-P3 ==
 
* common-name:
 
* common-name:
** a [dna ligase]-n6-(5'-adenylyl)-l-lysine
+
** 7,8-dihydroneopterin 3'-triphosphate
 +
* smiles:
 +
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
 +
* inchi-key:
 +
** dgguvlxvlhaagt-xinawcovsa-j
 +
* molecular-weight:
 +
** 491.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17918]]
+
* [[4.2.3.12-RXN]]
 +
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17917]]
+
* [[GTP-CYCLOHYDRO-I-RXN]]
* [[RXN-17920]]
 
* [[RXN-17924]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [dna ligase]-n6-(5'-adenylyl)-l-lysine}}
+
{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
 +
{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
 +
{{#set: molecular-weight=491.141}}

Revision as of 14:57, 5 January 2021

Metabolite DIHYDRONEOPTERIN-P3

  • common-name:
    • 7,8-dihydroneopterin 3'-triphosphate
  • smiles:
    • c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
  • inchi-key:
    • dgguvlxvlhaagt-xinawcovsa-j
  • molecular-weight:
    • 491.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality