Difference between revisions of "SUCROSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite Protein-Dithiols == * common-name: ** a protein dithiol == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRONEOPTERIN-P3 ==
+
== Metabolite Protein-Dithiols ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin 3'-triphosphate
+
** a protein dithiol
* smiles:
 
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
 
* inchi-key:
 
** dgguvlxvlhaagt-xinawcovsa-j
 
* molecular-weight:
 
** 491.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.2.3.12-RXN]]
+
* [[1.6.4.4-RXN]]
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+
* [[HDS]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTP-CYCLOHYDRO-I-RXN]]
+
* [[1.6.4.4-RXN]]
 +
* [[HDS]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
+
{{#set: common-name=a protein dithiol}}
{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
 
{{#set: molecular-weight=491.141}}
 

Revision as of 15:28, 5 January 2021

Metabolite Protein-Dithiols

  • common-name:
    • a protein dithiol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality