Difference between revisions of "SUCROSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DALADALALIG-RXN DALADALALIG-RXN] == * direction: ** left-to-right * common-name: ** d-alanine-d-ala...")
(Created page with "Category:metabolite == Metabolite SUCROSE == * common-name: ** sucrose * smiles: ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o * inchi-key: ** czmrcdwagmrecn-ugdnzrgbsa...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DALADALALIG-RXN DALADALALIG-RXN] ==
+
== Metabolite SUCROSE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** d-alanine-d-alanine ligase
+
** sucrose
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/6.3.2.4 ec-6.3.2.4]
+
** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 2 [[D-ALANINE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[D-ALA-D-ALA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** czmrcdwagmrecn-ugdnzrgbsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ17851]]
+
** 342.299
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[2.4.1.82-RXN]]
* Gene: [[SJ12670]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-11502]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ02214]]
+
{{#set: common-name=sucrose}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=czmrcdwagmrecn-ugdnzrgbsa-n}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=342.299}}
* Gene: [[SJ12870]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ06726]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY-7953]], UDP-N-acetylmuramoyl-pentapeptide biosynthesis III (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7953 PWY-7953]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6386]], UDP-N-acetylmuramoyl-pentapeptide biosynthesis II (lysine-containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6386 PWY-6386]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6387]], UDP-N-acetylmuramoyl-pentapeptide biosynthesis I (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6387 PWY-6387]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11224 11224]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01150 R01150]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/O83676 O83676]
 
** [http://www.uniprot.org/uniprot/O66806 O66806]
 
** [http://www.uniprot.org/uniprot/P46805 P46805]
 
** [http://www.uniprot.org/uniprot/P0A1F0 P0A1F0]
 
** [http://www.uniprot.org/uniprot/P0A6J8 P0A6J8]
 
** [http://www.uniprot.org/uniprot/P07862 P07862]
 
** [http://www.uniprot.org/uniprot/P96612 P96612]
 
** [http://www.uniprot.org/uniprot/Q9ZDS6 Q9ZDS6]
 
** [http://www.uniprot.org/uniprot/Q9CIL5 Q9CIL5]
 
** [http://www.uniprot.org/uniprot/P44405 P44405]
 
** [http://www.uniprot.org/uniprot/Q9PPC2 Q9PPC2]
 
** [http://www.uniprot.org/uniprot/Q9JSZ9 Q9JSZ9]
 
** [http://www.uniprot.org/uniprot/P35660 P35660]
 
** [http://www.uniprot.org/uniprot/P73632 P73632]
 
** [http://www.uniprot.org/uniprot/Q9XAK7 Q9XAK7]
 
** [http://www.uniprot.org/uniprot/Q9RLE4 Q9RLE4]
 
</div>
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=d-alanine-d-alanine ligase}}
 
{{#set: ec-number=ec-6.3.2.4}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SUCROSE

  • common-name:
    • sucrose
  • smiles:
    • c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
  • inchi-key:
    • czmrcdwagmrecn-ugdnzrgbsa-n
  • molecular-weight:
    • 342.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality