Difference between revisions of "SUCROSEUTIL2-PWY"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] ==
+== Pathway SUCROSEUTIL2-PWY ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** 3r-hydroxy-(11z)-eicos-11-enoyl-coa
+** sucrose degradation vii (sucrose 3-dehydrogenase)
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[FRUCTOKINASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** preomqknjxwclz-zhlmiuqrsa-j
+* [NoneKETOGLUCOSE-REDUCTASE-RXN KETOGLUCOSE-REDUCTASE-RXN]
-* molecular-weight:
+* [NoneGLUCOSIDE-3-DEHYDROGENASE-RXN GLUCOSIDE-3-DEHYDROGENASE-RXN]
-** 1072.006
+* [None3-KETOGLUCOSIDASE-RXN 3-KETOGLUCOSIDASE-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-1224}}
-* [[RXN-14485]]
+{{#set: common-name=sucrose degradation vii (sucrose 3-dehydrogenase)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-14484]]
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=3r-hydroxy-(11z)-eicos-11-enoyl-coa}}
-{{#set: inchi-key=inchikey=preomqknjxwclz-zhlmiuqrsa-j}}
-{{#set: molecular-weight=1072.006}}