Difference between revisions of "SULFMETII-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-320 CPD-320] == * common-name: ** ethylnitronate * smiles: ** cc=n(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * common-name: ** 4-hydroxybenzoate * smiles: ** c(c1(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxybenzoate |
* smiles: | * smiles: | ||
| − | ** cc= | + | ** c(c1(c=cc(=cc=1)o))(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fjkrolugyxjwqn-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 137.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
| + | * [[RXN-9003]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxybenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.115}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite 4-hydroxybenzoate
- common-name:
- 4-hydroxybenzoate
- smiles:
- c(c1(c=cc(=cc=1)o))(=o)[o-]
- inchi-key:
- fjkrolugyxjwqn-uhfffaoysa-m
- molecular-weight:
- 137.115
