Difference between revisions of "SULFMETII-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] ==
+== Pathway PWY-7158 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 3-oxo adrenoyl-coa
+** l-phenylalanine degradation v
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-13908]]
-* inchi-key:
+== Reaction(s) not found ==
-** vmajwsswcpbijy-kpovblhlsa-j
+* [NoneRXN-13907 RXN-13907]
-* molecular-weight:
+* [NoneRXN-13909 RXN-13909]
-** 1091.996
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-phenylalanine degradation v}}
-* [[RXN-16112]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=3-oxo adrenoyl-coa}}
-{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
-{{#set: molecular-weight=1091.996}}