Difference between revisions of "SULFO-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7064 == * common-name: ** primary fluorescent chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2...")
(Created page with "Category:metabolite == Metabolite CPD-8075 == * common-name: ** 1-18:2-2-16:1-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7064 ==
+
== Metabolite CPD-8075 ==
 
* common-name:
 
* common-name:
** primary fluorescent chlorophyll catabolite
+
** 1-18:2-2-16:1-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o)
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** vhqsfnuihpntmw-lryvnugjsa-m
+
** hghvcqzwrzwqks-cphkdgevsa-n
 
* molecular-weight:
 
* molecular-weight:
** 626.708
+
** 753.067
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8297]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7741]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=primary fluorescent chlorophyll catabolite}}
+
{{#set: common-name=1-18:2-2-16:1-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=vhqsfnuihpntmw-lryvnugjsa-m}}
+
{{#set: inchi-key=inchikey=hghvcqzwrzwqks-cphkdgevsa-n}}
{{#set: molecular-weight=626.708}}
+
{{#set: molecular-weight=753.067}}

Revision as of 18:56, 14 January 2021

Metabolite CPD-8075

  • common-name:
    • 1-18:2-2-16:1-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
  • inchi-key:
    • hghvcqzwrzwqks-cphkdgevsa-n
  • molecular-weight:
    • 753.067

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality