Difference between revisions of "SUMO-peptides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...")
(Created page with "Category:metabolite == Metabolite Carotenoid-beta-end-group == * common-name: ** a carotenoid β-end group == Reaction(s) known to consume the compound == == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-GLC-6-P ==
+
== Metabolite Carotenoid-beta-end-group ==
 
* common-name:
 
* common-name:
** α-d-glucose 6-phosphate
+
** a carotenoid β-end group
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
** nbschqhzlsjfnq-dvkngefbsa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[G6PADH]]
 
* [[G6PADHh]]
 
* [[G6PI]]
 
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGCM]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGMTh]]
 
* [[RXN-15312]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[G6PI]]
+
* [[RXN-12496]]
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGCM]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGMTh]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-glucose 6-phosphate}}
+
{{#set: common-name=a carotenoid β-end group}}
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 18:59, 14 January 2021

Metabolite Carotenoid-beta-end-group

  • common-name:
    • a carotenoid β-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality