Difference between revisions of "SUMO-peptides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17540 == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** wsfqksibzodgpb-o...") |
(Created page with "Category:metabolite == Metabolite Palmitoyl-lipid == * common-name: ** a [glycerolipid]-palmitate == Reaction(s) known to consume the compound == * RXN-16053 == Reacti...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Palmitoyl-lipid == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-palmitate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16053]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-palmitate}} |
| − | |||
| − | |||
Revision as of 08:31, 15 March 2021
Contents
Metabolite Palmitoyl-lipid
- common-name:
- a [glycerolipid]-palmitate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-palmitate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
