Difference between revisions of "SUMO-peptides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...") |
(Created page with "Category:metabolite == Metabolite SUMO-peptides == * common-name: ** a mature small ubiquitin-like modifier (sumo) peptide == Reaction(s) known to consume the compound ==...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SUMO-peptides == |
* common-name: | * common-name: | ||
− | ** | + | ** a mature small ubiquitin-like modifier (sumo) peptide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.4.22.68-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a mature small ubiquitin-like modifier (sumo) peptide}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite SUMO-peptides
- common-name:
- a mature small ubiquitin-like modifier (sumo) peptide