Difference between revisions of "SUMO-propeptides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXIDIZED-GLUTATHIONE == * common-name: ** glutathione disulfide * smiles: ** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-...")
(Created page with "Category:metabolite == Metabolite SUMO-propeptides == * common-name: ** a small ubiquitin-like modifier (sumo) propeptide == Reaction(s) known to consume the compound == *...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXIDIZED-GLUTATHIONE ==
+
== Metabolite SUMO-propeptides ==
 
* common-name:
 
* common-name:
** glutathione disulfide
+
** a small ubiquitin-like modifier (sumo) propeptide
* smiles:
 
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** ypzrwbkmtbyptk-bjdjzhngsa-l
 
* molecular-weight:
 
** 610.61
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GDR]]
+
* [[3.4.22.68-RXN]]
* [[GDR_LPAREN_nadp_RPAREN_]]
 
* [[GDR_LPAREN_nadp_RPAREN_h]]
 
* [[GDR_LPAREN_nadp_RPAREN_m]]
 
* [[GDRh]]
 
* [[GDRm]]
 
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.11.1.12-RXN]]
 
* [[1.8.4.9-RXN]]
 
* [[1.8.5.1-RXN]]
 
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 
* [[GTHP]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glutathione disulfide}}
+
{{#set: common-name=a small ubiquitin-like modifier (sumo) propeptide}}
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
 
{{#set: molecular-weight=610.61}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite SUMO-propeptides

  • common-name:
    • a small ubiquitin-like modifier (sumo) propeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality