Difference between revisions of "SUPER-OXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * smiles: ** c[n+](ccop([o-])([o-])=o)(c)c * inchi-key: ** yhhsonzfoiemcp-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CPD-569 == * common-name: ** n-acetylputrescine * smiles: ** cc(=o)ncccc[n+] * inchi-key: ** klzgkidsejwedw-uhfffaoysa-o * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-569 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetylputrescine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)ncccc[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** klzgkidsejwedw-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 131.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-1]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetylputrescine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=klzgkidsejwedw-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.197}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-569
- common-name:
- n-acetylputrescine
- smiles:
- cc(=o)ncccc[n+]
- inchi-key:
- klzgkidsejwedw-uhfffaoysa-o
- molecular-weight:
- 131.197
