Difference between revisions of "SUPER-OXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1) * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite SUPER-OXIDE == * common-name: ** superoxide * smiles: ** [o-]o * inchi-key: ** ouuqczgpvncoij-uhfffaoysa-m * molecular-weight: ** 31.999...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SUPER-OXIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** superoxide |
* smiles: | * smiles: | ||
− | ** | + | ** [o-]o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ouuqczgpvncoij-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 31.999 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[SUPEROX-DISMUT-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12615]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=superoxide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ouuqczgpvncoij-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=31.999}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite SUPER-OXIDE
- common-name:
- superoxide
- smiles:
- [o-]o
- inchi-key:
- ouuqczgpvncoij-uhfffaoysa-m
- molecular-weight:
- 31.999