Difference between revisions of "Saturated-2-Lysophosphatidates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7061 == * common-name: ** pheophorbide a * smiles: ** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=2...")
(Created page with "Category:metabolite == Metabolite Charged-SEC-tRNAs == * common-name: ** an l-selenocysteinyl-[trnasec] == Reaction(s) known to consume the compound == == Reaction(s) know...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7061 ==
+
== Metabolite Charged-SEC-tRNAs ==
 
* common-name:
 
* common-name:
** pheophorbide a
+
** an l-selenocysteinyl-[trnasec]
* smiles:
 
** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
 
* inchi-key:
 
** uxwyeazhzlzdgm-zvevzsnksa-m
 
* molecular-weight:
 
** 590.677
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17252]]
 
* [[RXN-7740]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10039]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pheophorbide a}}
+
{{#set: common-name=an l-selenocysteinyl-[trnasec]}}
{{#set: inchi-key=inchikey=uxwyeazhzlzdgm-zvevzsnksa-m}}
 
{{#set: molecular-weight=590.677}}
 

Revision as of 11:19, 15 January 2021

Metabolite Charged-SEC-tRNAs

  • common-name:
    • an l-selenocysteinyl-[trnasec]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-selenocysteinyl-[trnasec" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.