Difference between revisions of "Saturated-2-Lysophosphatidates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TRANS-3-METHYL-GLUTACONYL-COA == * common-name: ** 3-methylglutaconyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite Saturated-2-Lysophosphatidates == * common-name: ** a 2,3,4-saturated 2-lysophosphatidate == Reaction(s) known to consume the compound ==...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TRANS-3-METHYL-GLUTACONYL-COA ==
+
== Metabolite Saturated-2-Lysophosphatidates ==
 
* common-name:
 
* common-name:
** 3-methylglutaconyl-coa
+
** a 2,3,4-saturated 2-lysophosphatidate
* smiles:
 
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])cc(=o)[o-]
 
* inchi-key:
 
** gxkshrdahflwpn-rkylshmcsa-i
 
* molecular-weight:
 
** 888.606
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylglutaconyl-coa}}
+
{{#set: common-name=a 2,3,4-saturated 2-lysophosphatidate}}
{{#set: inchi-key=inchikey=gxkshrdahflwpn-rkylshmcsa-i}}
 
{{#set: molecular-weight=888.606}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Saturated-2-Lysophosphatidates

  • common-name:
    • a 2,3,4-saturated 2-lysophosphatidate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality