Difference between revisions of "Saturated-Fatty-Acyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-3-HYDROXYACYL-COA == * common-name: ** a (3r)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == * RXN-13279 * RXN...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,4)-bisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-3-HYDROXYACYL-COA ==
+
== Metabolite INOSITOL-1-4-BISPHOSPHATE ==
 
* common-name:
 
* common-name:
** a (3r)-3-hydroxyacyl-coa
+
** d-myo-inositol (1,4)-bisphosphate
 +
* smiles:
 +
** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
 +
* inchi-key:
 +
** pelzspzcxgtumr-rtphhqfdsa-j
 +
* molecular-weight:
 +
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279]]
+
* [[3.1.3.57-RXN]]
* [[RXN-17475]]
 
* [[RXN-7699]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279]]
+
* [[3.1.3.56-RXN]]
* [[RXN-17475]]
+
* [[RXN-13334]]
* [[RXN-7699]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r)-3-hydroxyacyl-coa}}
+
{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
 +
{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
 +
{{#set: molecular-weight=336.085}}

Revision as of 14:57, 5 January 2021

Metabolite INOSITOL-1-4-BISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • pelzspzcxgtumr-rtphhqfdsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality