Difference between revisions of "Secondary-Alcohols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi-key: ** fpwmcupfbrfmlh-xgaoum...") |
(Created page with "Category:metabolite == Metabolite PROPIONAMIDE == * common-name: ** propionamide * smiles: ** ccc(n)=o * inchi-key: ** qlnjfjadrcogbj-uhfffaoysa-n * molecular-weight: ** 7...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PROPIONAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** propionamide |
* smiles: | * smiles: | ||
− | ** | + | ** ccc(n)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qlnjfjadrcogbj-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 73.094 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14727]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=propionamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qlnjfjadrcogbj-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=73.094}} |
Revision as of 13:07, 14 January 2021
Contents
Metabolite PROPIONAMIDE
- common-name:
- propionamide
- smiles:
- ccc(n)=o
- inchi-key:
- qlnjfjadrcogbj-uhfffaoysa-n
- molecular-weight:
- 73.094